मुख्य कंटेंट तक स्किप करें

Fenwick Tree (Binary Indexed Tree)

knoxiboy
EditReport

The Fenwick Tree, also known as the Binary Indexed Tree (BIT), is a data structure that provides efficient methods for maintaining cumulative frequency tables. It allows for both updates and prefix sum calculations to be performed in logarithmic time.

Video Explanation​

Purpose​

The Fenwick Tree is used in situations where you need to efficiently perform the following operations:

  • Update: Update an element in the array.
  • Query: Calculate the sum of elements from the start of the array to a given index.

It is particularly useful in scenarios involving cumulative frequency tables, such as in statistical computations, game score calculations, and in various algorithms requiring range queries.

Operations​

  1. Update: Increment an element at a specific index by a given value.
  2. Query: Compute the sum of the elements from the start of the array to a given index.

Time Complexity​

  • Time Complexity: O(log n)O(log \ n) for both update and query operations, where n is the number of elements in the array.

Space Complexity​

  • Space Complexity: O(n)O(n) for storing the tree, where n is the number of elements.

Implementations​

C++​

#include <iostream>
#include <vector>
using namespace std;

class FenwickTree {
vector<int> tree;
int n;

public:
FenwickTree(int size) {
n = size;
tree.resize(n + 1, 0);
}

void update(int index, int value) {
for (; index <= n; index += index & -index) {
tree[index] += value;
}
}

int query(int index) {
int sum = 0;
for (; index > 0; index -= index & -index) {
sum += tree[index];
}
return sum;
}
};

Java​

class FenwickTree {
private int[] tree;
private int n;

public FenwickTree(int size) {
n = size;
tree = new int[n + 1];
}

public void update(int index, int value) {
for (; index <= n; index += index & -index) {
tree[index] += value;
}
}

public int query(int index) {
int sum = 0;
for (; index > 0; index -= index & -index) {
sum += tree[index];
}
return sum;
}
}

Python​

class FenwickTree:
def __init__(self, size):
self.size = size
self.tree = [0] * (size + 1)

def update(self, index, value):
while index <= self.size:
self.tree[index] += value
index += index & -index

def query(self, index):
sum = 0
while index > 0:
sum += self.tree[index]
index -= index & -index
return sum

Pseudo Code​

function FenwickTree(size):
tree = array of size (size + 1)
initialize all elements to 0

function update(index, value):
while index <= size:
tree[index] += value
index += index & -index

function query(index):
sum = 0
while index > 0:
sum += tree[index]
index -= index & -index
return sum

Complexity Cheat Sheet​

OperationBest CaseAverage CaseWorst CaseSpace Complexity
Point UpdateO(log⁡n)O(\log n)O(log⁡n)O(\log n)O(log⁡n)O(\log n)O(1)O(1)
Prefix Sum QueryO(log⁡n)O(\log n)O(log⁡n)O(\log n)O(log⁡n)O(\log n)O(1)O(1)
Range Sum QueryO(log⁡n)O(\log n)O(log⁡n)O(\log n)O(log⁡n)O(\log n)O(1)O(1)
Tree ConstructionO(n)O(n)O(n)O(n)O(n)O(n)O(n)O(n)
Overall Storage---O(n)O(n)

Conclusion​

The Fenwick Tree (Binary Indexed Tree) is a powerful data structure for efficiently managing cumulative frequency tables and performing range queries. Its ability to update and query sums in logarithmic time makes it a valuable tool in various algorithmic applications.

Track Your Progress

Done with this topic? Mark it as complete to track your progress.

Was this page helpful?

💬

Discuss this page

Have a question or spot something confusing in "Fenwick Tree (Binary Indexed Tree)"? Ask below. Backed by GitHub Discussions—maintainers receive system notifications directly.