Skip to main content

Fenwick Tree (Binary Indexed Tree)

knoxiboy
EditReport

The Fenwick Tree, also known as the Binary Indexed Tree (BIT), is a data structure that provides efficient methods for maintaining cumulative frequency tables. It allows for both updates and prefix sum calculations to be performed in logarithmic time.

Video Explanation

Purpose

The Fenwick Tree is used in situations where you need to efficiently perform the following operations:

  • Update: Update an element in the array.
  • Query: Calculate the sum of elements from the start of the array to a given index.

It is particularly useful in scenarios involving cumulative frequency tables, such as in statistical computations, game score calculations, and in various algorithms requiring range queries.

Operations

  1. Update: Increment an element at a specific index by a given value.
  2. Query: Compute the sum of the elements from the start of the array to a given index.

Time Complexity

  • Time Complexity: O(log n)O(log \ n) for both update and query operations, where n is the number of elements in the array.

Space Complexity

  • Space Complexity: O(n)O(n) for storing the tree, where n is the number of elements.

Implementations

C++

#include <iostream>
#include <vector>
using namespace std;

class FenwickTree {
vector<int> tree;
int n;

public:
FenwickTree(int size) {
n = size;
tree.resize(n + 1, 0);
}

void update(int index, int value) {
for (; index <= n; index += index & -index) {
tree[index] += value;
}
}

int query(int index) {
int sum = 0;
for (; index > 0; index -= index & -index) {
sum += tree[index];
}
return sum;
}
};

Java

class FenwickTree {
private int[] tree;
private int n;

public FenwickTree(int size) {
n = size;
tree = new int[n + 1];
}

public void update(int index, int value) {
for (; index <= n; index += index & -index) {
tree[index] += value;
}
}

public int query(int index) {
int sum = 0;
for (; index > 0; index -= index & -index) {
sum += tree[index];
}
return sum;
}
}

Python

class FenwickTree:
def __init__(self, size):
self.size = size
self.tree = [0] * (size + 1)

def update(self, index, value):
while index <= self.size:
self.tree[index] += value
index += index & -index

def query(self, index):
sum = 0
while index > 0:
sum += self.tree[index]
index -= index & -index
return sum

Pseudo Code

function FenwickTree(size):
tree = array of size (size + 1)
initialize all elements to 0

function update(index, value):
while index <= size:
tree[index] += value
index += index & -index

function query(index):
sum = 0
while index > 0:
sum += tree[index]
index -= index & -index
return sum

Complexity Cheat Sheet

OperationBest CaseAverage CaseWorst CaseSpace Complexity
Point UpdateO(logn)O(\log n)O(logn)O(\log n)O(logn)O(\log n)O(1)O(1)
Prefix Sum QueryO(logn)O(\log n)O(logn)O(\log n)O(logn)O(\log n)O(1)O(1)
Range Sum QueryO(logn)O(\log n)O(logn)O(\log n)O(logn)O(\log n)O(1)O(1)
Tree ConstructionO(n)O(n)O(n)O(n)O(n)O(n)O(n)O(n)
Overall Storage---O(n)O(n)

Conclusion

The Fenwick Tree (Binary Indexed Tree) is a powerful data structure for efficiently managing cumulative frequency tables and performing range queries. Its ability to update and query sums in logarithmic time makes it a valuable tool in various algorithmic applications.

Track Your Progress

Done with this topic? Mark it as complete to track your progress.

Was this page helpful?

💬

Discuss this page

Have a question or spot something confusing in "Fenwick Tree (Binary Indexed Tree)"? Ask below. Backed by GitHub Discussions—maintainers receive system notifications directly.