Skip to main content

Disjoint Set Union (Union-Find)

knoxiboy
EditReport

Disjoint Set Union (Union-Find)

The Disjoint Set Union (DSU), also known as Union-Find, is an efficient data structure that tracks a collection of disjoint (non-overlapping) sets. It supports two main operations efficiently:

  • Find: Determine the root or representative of the set containing a specific element.
  • Union: Merge two sets into a single set.

Video Explanation​

Purpose​

The Union-Find data structure is widely used in algorithms that require grouping elements and checking for connectivity, such as:

  • Dynamic connectivity problems.
  • Kruskal’s Algorithm for finding the Minimum Spanning Tree (MST) in graphs.
  • Network connectivity.

Operations​

  1. Make Set: Initialize a set with a single element.
  2. Find: Determine the root of the set containing the element.
  3. Union: Join two sets.

Time Complexity​

  • Time Complexity: O(α(n))O(α(n)) per operation, where α(n)α(n) is the inverse Ackermann function, which grows extremely slowly.

Implementations​

C++​

#include <iostream>
using namespace std;

class DisjointSet {
int *parent, *rank;
int n;

public:
DisjointSet(int n) {
this->n = n;
parent = new int[n];
rank = new int[n];
for (int i = 0; i < n; i++) {
parent[i] = i;
rank[i] = 0;
}
}

int find(int v) {
if (v == parent[v])
return v;
return parent[v] = find(parent[v]); // Path compression
}

void unionSets(int a, int b) {
a = find(a);
b = find(b);
if (a != b) {
if (rank[a] < rank[b])
swap(a, b);
parent[b] = a;
if (rank[a] == rank[b])
rank[a]++;
}
}
};

Java​

class DisjointSet {
private int[] parent, rank;

public DisjointSet(int n) {
parent = new int[n];
rank = new int[n];
for (int i = 0; i < n; i++) {
parent[i] = i;
rank[i] = 0;
}
}

public int find(int v) {
if (v == parent[v])
return v;
return parent[v] = find(parent[v]); // Path compression
}

public void union(int a, int b) {
a = find(a);
b = find(b);
if (a != b) {
if (rank[a] < rank[b])
swap(a, b);
parent[b] = a;
if (rank[a] == rank[b])
rank[a]++;
}
}

private void swap(int a, int b) {
int temp = a;
a = b;
b = temp;
}
}

Python​

class DisjointSet:
def __init__(self, n):
self.parent = [i for i in range(n)]
self.rank = [0] * n

def find(self, v):
if v != self.parent[v]:
self.parent[v] = self.find(self.parent[v]) # Path compression
return self.parent[v]

def union(self, a, b):
a = self.find(a)
b = self.find(b)
if a != b:
if self.rank[a] < self.rank[b]:
a, b = b, a
self.parent[b] = a
if self.rank[a] == self.rank[b]:
self.rank[a] += 1

Pseudo Code​

function makeSet(n):
parent = array of size n
rank = array of size n
for i from 0 to n-1:
parent[i] = i
rank[i] = 0

function find(v):
if v == parent[v]:
return v
parent[v] = find(parent[v]) // Path compression
return parent[v]

function union(a, b):
a = find(a)
b = find(b)
if a != b:
if rank[a] < rank[b]:
swap(a, b)
parent[b] = a
if rank[a] == rank[b]:
rank[a] += 1

Complexity Cheat Sheet​

OperationWithout OptimizationsWith Path Compression + Union by RankSpace Complexity
Make SetO(1)O(1)O(1)O(1)O(n)O(n)
FindO(n)O(n)O(α(n))O(\alpha(n)) amortizedO(1)O(1)
UnionO(n)O(n)O(α(n))O(\alpha(n)) amortizedO(1)O(1)
Overall Storage--O(n)O(n)

Here α(n)\alpha(n) is the inverse Ackermann function, which grows so slowly that it is effectively constant (≤4\leq 4) for all practical input sizes.

Conclusion​

The Disjoint Set Union (Union-Find) is an essential data structure for efficiently managing disjoint sets and performing union and find operations. Its applications in network connectivity and graph algorithms make it a fundamental topic in data structures and algorithms.

Track Your Progress

Done with this topic? Mark it as complete to track your progress.

Was this page helpful?

💬

Discuss this page

Have a question or spot something confusing in "Disjoint Set Union (Union-Find)"? Ask below. Backed by GitHub Discussions—maintainers receive system notifications directly.