मुख्य कंटेंट तक स्किप करें

Circular Queue Data Structure

knoxiboy
EditReport

Introduction to Circular Queue​

A circular queue is a linear data structure that follows the First In First Out (FIFO) principle, similar to a regular queue. However, in a circular queue, the last position is connected back to the first position to form a circle. This circular arrangement allows for efficient use of space, as it enables the queue to utilize any free space created by dequeue operations without shifting elements.

alt text

Video Explanation​

Circular Queue Operations​

  1. Enqueue: Add an element to the back of the queue.
  2. Dequeue: Remove the element from the front of the queue.
  3. Peek: Retrieve the element at the front of the queue without removing it.
  4. isEmpty: Check if the queue is empty.
  5. isFull: Check if the queue is full.
  6. Size: Get the number of elements in the queue.

Pseudocode​

Basic Operations​

  1. Enqueue:

    function enqueue(circularQueue, element):
    if isFull(circularQueue):
    return "Queue Overflow"
    circularQueue.rear = (circularQueue.rear + 1) % circularQueue.size
    circularQueue.elements[circularQueue.rear] = element
  2. Dequeue:

    function dequeue(circularQueue):
    if isEmpty(circularQueue):
    return "Queue Underflow"
    frontElement = circularQueue.elements[circularQueue.front]
    circularQueue.front = (circularQueue.front + 1) % circularQueue.size
    return frontElement
  3. Peek:

    function peek(circularQueue):
    if isEmpty(circularQueue):
    return "Queue is empty"
    return circularQueue.elements[circularQueue.front]
  4. isEmpty:

    function isEmpty(circularQueue):
    return circularQueue.front == circularQueue.rear
  5. isFull:

    function isFull(circularQueue):
    return (circularQueue.rear + 1) % circularQueue.size == circularQueue.front
  6. Size:

    function size(circularQueue):
    return (circularQueue.rear - circularQueue.front + circularQueue.size) % circularQueue.size

Implementation in Python, C++, and Java​

Python Implementation​

class CircularQueue:
def __init__(self, size):
self.size = size
self.elements = [None] * size
self.front = 0
self.rear = 0

def enqueue(self, element):
if self.is_full():
return "Queue Overflow"
self.rear = (self.rear + 1) % self.size
self.elements[self.rear] = element

def dequeue(self):
if self.is_empty():
return "Queue Underflow"
frontElement = self.elements[self.front]
self.front = (self.front + 1) % self.size
return frontElement

def peek(self):
if self.is_empty():
return "Queue is empty"
return self.elements[self.front]

def is_empty(self):
return self.front == self.rear

def is_full(self):
return (self.rear + 1) % self.size == self.front

def size(self):
return (self.rear - self.front + self.size) % self.size

# Example usage
cq = CircularQueue(5)
cq.enqueue(10)
cq.enqueue(20)
print(cq.dequeue()) # Output: 10
print(cq.peek()) # Output: 20
print(cq.is_empty()) # Output: False
print(cq.size()) # Output: 1

C++ Implementation​

#include <iostream>
using namespace std;

class CircularQueue {
private:
int *elements;
int front, rear, size;

public:
CircularQueue(int size) {
this->size = size;
elements = new int[size];
front = rear = 0;
}

void enqueue(int element) {
if (is_full()) {
cout << "Queue Overflow" << endl;
return;
}
rear = (rear + 1) % size;
elements[rear] = element;
}

int dequeue() {
if (is_empty()) {
cout << "Queue Underflow" << endl;
return -1; // Indicating underflow
}
int frontElement = elements[front];
front = (front + 1) % size;
return frontElement;
}

int peek() {
if (is_empty()) {
cout << "Queue is empty" << endl;
return -1; // Indicating empty
}
return elements[front];
}

bool is_empty() {
return front == rear;
}

bool is_full() {
return (rear + 1) % size == front;
}

int size_of_queue() {
return (rear - front + size) % size;
}

~CircularQueue() {
delete[] elements;
}
};

// Example usage
int main() {
CircularQueue cq(5);
cq.enqueue(10);
cq.enqueue(20);
cout << cq.dequeue() << endl; // Output: 10
cout << cq.peek() << endl; // Output: 20
cout << boolalpha << cq.is_empty() << endl; // Output: false
cout << cq.size_of_queue() << endl; // Output: 1
return 0;
}

Java Implementation​

public class CircularQueue {
private int[] elements;
private int front, rear, size;

public CircularQueue(int size) {
this.size = size;
elements = new int[size];
front = rear = 0;
}

public void enqueue(int element) {
if (is_full()) {
System.out.println("Queue Overflow");
return;
}
rear = (rear + 1) % size;
elements[rear] = element;
}

public int dequeue() {
if (is_empty()) {
System.out.println("Queue Underflow");
return -1; // Indicating underflow
}
int frontElement = elements[front];
front = (front + 1) % size;
return frontElement;
}

public int peek() {
if (is_empty()) {
System.out.println("Queue is empty");
return -1; // Indicating empty
}
return elements[front];
}

public boolean is_empty() {
return front == rear;
}

public boolean is_full() {
return (rear + 1) % size == front;
}

public int size_of_queue() {
return (rear - front + size) % size;
}

// Example usage
public static void main(String[] args) {
CircularQueue cq = new CircularQueue(5);
cq.enqueue(10);
cq.enqueue(20);
System.out.println(cq.dequeue()); // Output: 10
System.out.println(cq.peek()); // Output: 20
System.out.println(cq.is_empty()); // Output: false
System.out.println(cq.size_of_queue()); // Output: 1
}
}

C Implementation​

#include <stdio.h>

#define SIZE 5

int items[SIZE];
int front = -1, rear = -1;

// Check if the queue is full
int isFull() {
return (front == (rear + 1) % SIZE) || (front == 0 && rear == SIZE - 1);
}

// Check if the queue is empty
int isEmpty() {
return front == -1;
}

// Add an element to the queue
void enQueue(int element) {
if (isFull()) {
printf("\nQueue is full!!\n");
} else {
if (isEmpty()) {
front = 0;
}
rear = (rear + 1) % SIZE;
items[rear] = element;
printf("\nInserted -> %d", element);
}
}

// Remove an element from the queue
int deQueue() {
if (isEmpty()) {
printf("\nQueue is empty!!\n");
return -1;
} else {
int element = items[front];
if (front == rear) { // Queue has only one element
front = -1;
rear = -1;
} else {
front = (front + 1) % SIZE;
}
printf("\nDeleted element -> %d\n", element);
return element;
}
}

// Display the elements in the queue
void display() {
if (isEmpty()) {
printf("\nEmpty Queue\n");
} else {
printf("\nFront -> %d\n", front);
printf("Items -> ");
for (int i = front; i != rear; i = (i + 1) % SIZE) {
printf("%d ", items[i]);
}
printf("%d ", items[rear]); // Print the last element
printf("\nRear -> %d\n", rear);
}
}

int main() {
deQueue(); // Attempt to dequeue from an empty queue

enQueue(1);
enQueue(2);
enQueue(3);
enQueue(4);
enQueue(5);

enQueue(6); // Attempt to enqueue into a full queue

display(); // Display the queue

deQueue(); // Dequeue one element
display(); // Display the queue again

enQueue(7); // Enqueue one element to test circular queue functionality
display(); // Display the queue

enQueue(8); // Attempt to enqueue into a full queue

return 0;
}

Complexity Cheat Sheet​

OperationBest CaseAverage CaseWorst CaseSpace Complexity
EnqueueO(1)O(1)O(1)O(1)O(1)O(1)O(1)O(1)
DequeueO(1)O(1)O(1)O(1)O(1)O(1)O(1)O(1)
PeekO(1)O(1)O(1)O(1)O(1)O(1)O(1)O(1)
isEmpty / isFullO(1)O(1)O(1)O(1)O(1)O(1)O(1)O(1)
SizeO(1)O(1)O(1)O(1)O(1)O(1)O(1)O(1)
Overall Queue Storage---O(n)O(n)

Example​

Consider a circular queue with the following operations:

  1. Enqueue 10
  2. Enqueue 20
  3. Dequeue
  4. Peek
  5. Check if empty
  6. Get size

Operations:

  • Enqueue 10: Queue becomes [10, _, _, _, _]
  • Enqueue 20: Queue becomes [10, 20, _, _, _]
  • Dequeue: Removes 10, Queue becomes [_, 20, _, _, _]
  • Peek: Returns 20, Queue remains [_, 20, _, _, _]
  • isEmpty: Returns false
  • Size: Returns 1

Conclusion​

A circular queue is an efficient data structure that improves the utilization of space in scenarios where a standard linear queue might lead to wasted memory due to the shifting of elements. It is widely used in applications such as CPU scheduling, resource sharing, and buffering tasks in operating systems. Understanding and implementing a circular queue can significantly enhance performance and memory management in various algorithms and systems.

Track Your Progress

Done with this topic? Mark it as complete to track your progress.

Was this page helpful?

💬

Discuss this page

Have a question or spot something confusing in "Circular Queue Data Structure"? Ask below. Backed by GitHub Discussions—maintainers receive system notifications directly.